C25H31NO3S — CID 10670080
(1R,10bR)-1-benzyl-10b-butyl-8,9-dimethoxy-1-methyl-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-3-one (PubChem CID 10670080) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is (1R,10bR)-1-benzyl-10b-butyl-8,9-dimethoxy-1-methyl-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-3-one.
| Compound Name | (1R,10bR)-1-benzyl-10b-butyl-8,9-dimethoxy-1-methyl-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-3-one |
|---|---|
| PubChem CID | 10670080 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (1R,10bR)-1-benzyl-10b-butyl-8,9-dimethoxy-1-methyl-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-3-one |
| SMILES | CCCC[C@]12c3cc(OC)c(OC)cc3CCN1C(=O)S[C@]2(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H31NO3S/c1-5-6-13-25-20-16-22(29-4)21(28-3)15-19(20)12-14-26(25)23(27)30-24(25,2)17-18-10-8-7-9-11-18/h7-11,15-16H,5-6,12-14,17H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | YWUITKNTLZJQSA-JWQCQUIFSA-N |
| XLogP | 5.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|