C50H48N2O8 — CID 69307332
bis[6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-3,4-dihydro-2H-isoquinolin-1-yl] oxalate (PubChem CID 69307332) has the molecular formula C50H48N2O8 and a molecular weight of 804.94 g/mol. Its IUPAC name is bis[6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-3,4-dihydro-2H-isoquinolin-1-yl] oxalate.
| Compound Name | bis[6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-3,4-dihydro-2H-isoquinolin-1-yl] oxalate |
|---|---|
| PubChem CID | 69307332 |
| Molecular Formula | C50H48N2O8 |
| Molecular Weight | 804.94 g/mol |
| Exact Mass | 804.34 |
| IUPAC Name | bis[6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-3,4-dihydro-2H-isoquinolin-1-yl] oxalate |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(-c3ccccc3)cc1)(OC(=O)C(=O)OC1(Cc3ccc(-c4ccccc4)cc3)NCCc3cc(OC)c(OC)cc31)NCC2 |
| InChI | InChI=1S/C50H48N2O8/c1-55-43-27-39-23-25-51-49(41(39)29-45(43)57-3,31-33-15-19-37(20-16-33)35-11-7-5-8-12-35)59-47(53)48(54)60-50(32-34-17-21-38(22-18-34)36-13-9-6-10-14-36)42-30-46(58-4)44(56-2)28-40(42)24-26-52-50/h5-22,27-30,51-52H,23-26,31-32H2,1-4H3 |
| InChIKey | VGNGWMUDFYLHOK-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.94 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|