C36H34N4O6 — CID 101079633
4,5,16,17-tetramethoxy-12,24-diphenyl-10,12,22,24-tetrazahexacyclo[11.11.0.01,10.02,7.013,22.014,19]tetracosa-2,4,6,14,16,18-hexaene-11,23-dione (PubChem CID 101079633) has the molecular formula C36H34N4O6 and a molecular weight of 618.69 g/mol. Its IUPAC name is 4,5,16,17-tetramethoxy-12,24-diphenyl-10,12,22,24-tetrazahexacyclo[11.11.0.01,10.02,7.013,22.014,19]tetracosa-2,4,6,14,16,18-hexaene-11,23-dione.
| Compound Name | 4,5,16,17-tetramethoxy-12,24-diphenyl-10,12,22,24-tetrazahexacyclo[11.11.0.01,10.02,7.013,22.014,19]tetracosa-2,4,6,14,16,18-hexaene-11,23-dione |
|---|---|
| PubChem CID | 101079633 |
| Molecular Formula | C36H34N4O6 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 4,5,16,17-tetramethoxy-12,24-diphenyl-10,12,22,24-tetrazahexacyclo[11.11.0.01,10.02,7.013,22.014,19]tetracosa-2,4,6,14,16,18-hexaene-11,23-dione |
| SMILES | COc1cc2c(cc1OC)C13N(CC2)C(=O)N(c2ccccc2)C12c1cc(OC)c(OC)cc1CCN2C(=O)N3c1ccccc1 |
| InChI | InChI=1S/C36H34N4O6/c1-43-29-19-23-15-17-37-33(41)40(26-13-9-6-10-14-26)36-28-22-32(46-4)30(44-2)20-24(28)16-18-38(36)34(42)39(25-11-7-5-8-12-25)35(36,37)27(23)21-31(29)45-3/h5-14,19-22H,15-18H2,1-4H3 |
| InChIKey | VMJXCPGCPFCTOB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |