C25H23NO4 — CID 102421500
2-benzoyl-6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinoline-1-carbaldehyde (PubChem CID 102421500) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-benzoyl-6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinoline-1-carbaldehyde.
| Compound Name | 2-benzoyl-6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 102421500 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-benzoyl-6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinoline-1-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)C(C=O)(c1ccccc1)N(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C25H23NO4/c1-29-22-15-19-13-14-26(24(28)18-9-5-3-6-10-18)25(17-27,20-11-7-4-8-12-20)21(19)16-23(22)30-2/h3-12,15-17H,13-14H2,1-2H3 |
| InChIKey | VLHONGRJNPBXFE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|