C44H50N2O10 — CID 67930192
bis(3-ethyl-7,8-dimethoxy-5-phenoxy-2,4-dihydro-1H-3-benzazepin-5-yl) (Z)-but-2-enedioate (PubChem CID 67930192) has the molecular formula C44H50N2O10 and a molecular weight of 766.89 g/mol. Its IUPAC name is bis(3-ethyl-7,8-dimethoxy-5-phenoxy-2,4-dihydro-1H-3-benzazepin-5-yl) (Z)-but-2-enedioate.
| Compound Name | bis(3-ethyl-7,8-dimethoxy-5-phenoxy-2,4-dihydro-1H-3-benzazepin-5-yl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67930192 |
| Molecular Formula | C44H50N2O10 |
| Molecular Weight | 766.89 g/mol |
| Exact Mass | 766.35 |
| IUPAC Name | bis(3-ethyl-7,8-dimethoxy-5-phenoxy-2,4-dihydro-1H-3-benzazepin-5-yl) (Z)-but-2-enedioate |
| SMILES | CCN1CCc2cc(OC)c(OC)cc2C(OC(=O)/C=C\C(=O)OC2(Oc3ccccc3)CN(CC)CCc3cc(OC)c(OC)cc32)(Oc2ccccc2)C1 |
| InChI | InChI=1S/C44H50N2O10/c1-7-45-23-21-31-25-37(49-3)39(51-5)27-35(31)43(29-45,53-33-15-11-9-12-16-33)55-41(47)19-20-42(48)56-44(54-34-17-13-10-14-18-34)30-46(8-2)24-22-32-26-38(50-4)40(52-6)28-36(32)44/h9-20,25-28H,7-8,21-24,29-30H2,1-6H3/b20-19- |
| InChIKey | VTZZMUKMEKNOST-VXPUYCOJSA-N |
| XLogP | 6.28 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.89 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|