C24H29NO7 — CID 67930193
but-2-enedioic acid;3-ethyl-7,8-dimethoxy-5-phenoxy-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 67930193) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is but-2-enedioic acid;3-ethyl-7,8-dimethoxy-5-phenoxy-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | but-2-enedioic acid;3-ethyl-7,8-dimethoxy-5-phenoxy-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 67930193 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | but-2-enedioic acid;3-ethyl-7,8-dimethoxy-5-phenoxy-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | CCN1CCc2cc(OC)c(OC)cc2C(Oc2ccccc2)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H25NO3.C4H4O4/c1-4-21-11-10-15-12-18(22-2)19(23-3)13-17(15)20(14-21)24-16-8-6-5-7-9-16;5-3(6)1-2-4(7)8/h5-9,12-13,20H,4,10-11,14H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | ATHNWODHOWZNEQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|