C22H26FNO7 — CID 14349089
3-ethyl-5-(4-fluorophenoxy)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine;oxalic acid (PubChem CID 14349089) has the molecular formula C22H26FNO7 and a molecular weight of 435.45 g/mol. Its IUPAC name is 3-ethyl-5-(4-fluorophenoxy)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine;oxalic acid.
| Compound Name | 3-ethyl-5-(4-fluorophenoxy)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine;oxalic acid |
|---|---|
| PubChem CID | 14349089 |
| Molecular Formula | C22H26FNO7 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-ethyl-5-(4-fluorophenoxy)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine;oxalic acid |
| SMILES | CCN1CCc2cc(OC)c(OC)cc2C(Oc2ccc(F)cc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H24FNO3.C2H2O4/c1-4-22-10-9-14-11-18(23-2)19(24-3)12-17(14)20(13-22)25-16-7-5-15(21)6-8-16;3-1(4)2(5)6/h5-8,11-12,20H,4,9-10,13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | FROZBAWZHNGGTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|