C44H44N4O10 — CID 67931954
bis[5-(4-cyanophenoxy)-7,8-dimethoxy-3-methyl-2,4-dihydro-1H-3-benzazepin-5-yl] (Z)-but-2-enedioate (PubChem CID 67931954) has the molecular formula C44H44N4O10 and a molecular weight of 788.85 g/mol. Its IUPAC name is bis[5-(4-cyanophenoxy)-7,8-dimethoxy-3-methyl-2,4-dihydro-1H-3-benzazepin-5-yl] (Z)-but-2-enedioate.
| Compound Name | bis[5-(4-cyanophenoxy)-7,8-dimethoxy-3-methyl-2,4-dihydro-1H-3-benzazepin-5-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67931954 |
| Molecular Formula | C44H44N4O10 |
| Molecular Weight | 788.85 g/mol |
| Exact Mass | 788.31 |
| IUPAC Name | bis[5-(4-cyanophenoxy)-7,8-dimethoxy-3-methyl-2,4-dihydro-1H-3-benzazepin-5-yl] (Z)-but-2-enedioate |
| SMILES | COc1cc2c(cc1OC)C(OC(=O)/C=C\C(=O)OC1(Oc3ccc(C#N)cc3)CN(C)CCc3cc(OC)c(OC)cc31)(Oc1ccc(C#N)cc1)CN(C)CC2 |
| InChI | InChI=1S/C44H44N4O10/c1-47-19-17-31-21-37(51-3)39(53-5)23-35(31)43(27-47,55-33-11-7-29(25-45)8-12-33)57-41(49)15-16-42(50)58-44(56-34-13-9-30(26-46)10-14-34)28-48(2)20-18-32-22-38(52-4)40(54-6)24-36(32)44/h7-16,21-24H,17-20,27-28H2,1-6H3/b16-15- |
| InChIKey | GNVFHWRCNADDFG-NXVVXOECSA-N |
| XLogP | 5.25 |
| TPSA | 162.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|