C16H20O3 — CID 162733767
5,6-dimethoxy-1-(2-methylprop-2-enyl)-2,3-dihydroindene-1-carbaldehyde (PubChem CID 162733767) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 5,6-dimethoxy-1-(2-methylprop-2-enyl)-2,3-dihydroindene-1-carbaldehyde.
| Compound Name | 5,6-dimethoxy-1-(2-methylprop-2-enyl)-2,3-dihydroindene-1-carbaldehyde |
|---|---|
| PubChem CID | 162733767 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5,6-dimethoxy-1-(2-methylprop-2-enyl)-2,3-dihydroindene-1-carbaldehyde |
| SMILES | C=C(C)CC1(C=O)CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C16H20O3/c1-11(2)9-16(10-17)6-5-12-7-14(18-3)15(19-4)8-13(12)16/h7-8,10H,1,5-6,9H2,2-4H3 |
| InChIKey | BSQBIPMGDLMIJI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|