C18H18BrClO3 — CID 42587898
(1S)-1-(bromomethyl)-1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydroisochromene (PubChem CID 42587898) has the molecular formula C18H18BrClO3 and a molecular weight of 397.70 g/mol. Its IUPAC name is (1S)-1-(bromomethyl)-1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydroisochromene.
| Compound Name | (1S)-1-(bromomethyl)-1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydroisochromene |
|---|---|
| PubChem CID | 42587898 |
| Molecular Formula | C18H18BrClO3 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | (1S)-1-(bromomethyl)-1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydroisochromene |
| SMILES | COc1cc2c(cc1OC)[C@](CBr)(c1ccc(Cl)cc1)OCC2 |
| InChI | InChI=1S/C18H18BrClO3/c1-21-16-9-12-7-8-23-18(11-19,15(12)10-17(16)22-2)13-3-5-14(20)6-4-13/h3-6,9-10H,7-8,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | UHSYWYJAXALOGX-SFHVURJKSA-N |
| XLogP | 4.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|