C22H18FN3O2 — CID 72777048
3-fluoro-8,9-dimethoxy-10b-phenyl-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-1,2-dicarbonitrile (PubChem CID 72777048) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 3-fluoro-8,9-dimethoxy-10b-phenyl-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-1,2-dicarbonitrile.
| Compound Name | 3-fluoro-8,9-dimethoxy-10b-phenyl-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 72777048 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-fluoro-8,9-dimethoxy-10b-phenyl-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-1,2-dicarbonitrile |
| SMILES | COc1cc2c(cc1OC)C1(c3ccccc3)C(C#N)C(C#N)=C(F)N1CC2 |
| InChI | InChI=1S/C22H18FN3O2/c1-27-19-10-14-8-9-26-21(23)16(12-24)18(13-25)22(26,15-6-4-3-5-7-15)17(14)11-20(19)28-2/h3-7,10-11,18H,8-9H2,1-2H3 |
| InChIKey | JXGGNXQZMRFBGV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|