C28H35NO5Si — CID 102070761
(1S,2R,10bR)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,9-dimethoxy-10b-(2-phenylethynyl)-1,2,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-3-one (PubChem CID 102070761) has the molecular formula C28H35NO5Si and a molecular weight of 493.68 g/mol. Its IUPAC name is (1S,2R,10bR)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,9-dimethoxy-10b-(2-phenylethynyl)-1,2,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-3-one.
| Compound Name | (1S,2R,10bR)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,9-dimethoxy-10b-(2-phenylethynyl)-1,2,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-3-one |
|---|---|
| PubChem CID | 102070761 |
| Molecular Formula | C28H35NO5Si |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (1S,2R,10bR)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,9-dimethoxy-10b-(2-phenylethynyl)-1,2,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-3-one |
| SMILES | COc1cc2c(cc1OC)[C@]1(C#Cc3ccccc3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1CC2 |
| InChI | InChI=1S/C28H35NO5Si/c1-27(2,3)35(6,7)34-24-25(30)28(15-13-19-11-9-8-10-12-19)21-18-23(33-5)22(32-4)17-20(21)14-16-29(28)26(24)31/h8-12,17-18,24-25,30H,14,16H2,1-7H3/t24-,25-,28-/m1/s1 |
| InChIKey | BQTOWSWYGUZDGX-INNMJMHTSA-N |
| XLogP | 4.10 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|