C33H43NO4Si — CID 11180333
[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydroisoquinolin-1-yl]methanol (PubChem CID 11180333) has the molecular formula C33H43NO4Si and a molecular weight of 545.80 g/mol. Its IUPAC name is [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydroisoquinolin-1-yl]methanol.
| Compound Name | [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydroisoquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 11180333 |
| Molecular Formula | C33H43NO4Si |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydroisoquinolin-1-yl]methanol |
| SMILES | C=CCN1CCc2cc(OC)c(OC)cc2C1(CO)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H43NO4Si/c1-7-20-34-21-18-26-23-30(36-5)31(37-6)24-29(26)33(34,25-35)19-22-38-39(32(2,3)4,27-14-10-8-11-15-27)28-16-12-9-13-17-28/h7-17,23-24,35H,1,18-22,25H2,2-6H3 |
| InChIKey | BZZWWRVJFCLYBI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|