C23H24N2O4 — CID 90910801
3-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-6-(2-phenylethynyl)-1,6-dihydropyrimidin-2-one (PubChem CID 90910801) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-6-(2-phenylethynyl)-1,6-dihydropyrimidin-2-one.
| Compound Name | 3-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-6-(2-phenylethynyl)-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 90910801 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-6-(2-phenylethynyl)-1,6-dihydropyrimidin-2-one |
| SMILES | COc1cc(N2C=CC(C#Cc3ccccc3)NC2=O)ccc1OCC(C)(C)O |
| InChI | InChI=1S/C23H24N2O4/c1-23(2,27)16-29-20-12-11-19(15-21(20)28-3)25-14-13-18(24-22(25)26)10-9-17-7-5-4-6-8-17/h4-8,11-15,18,27H,16H2,1-3H3,(H,24,26) |
| InChIKey | MMULYVXOXLUUPN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|