C18H22NO3 — CID 102016574
CID 102016574 (PubChem CID 102016574) has the molecular formula C18H22NO3 and a molecular weight of 300.38 g/mol.
| Compound Name | CID 102016574 |
|---|---|
| PubChem CID | 102016574 |
| Molecular Formula | C18H22NO3 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | — |
| SMILES | [CH2]CN1CCc2cc(OC)c(OC)cc2C12C=CC(=O)CC2 |
| InChI | InChI=1S/C18H22NO3/c1-4-19-10-7-13-11-16(21-2)17(22-3)12-15(13)18(19)8-5-14(20)6-9-18/h5,8,11-12H,1,4,6-7,9-10H2,2-3H3 |
| InChIKey | CIEUHBKIJDGLRJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |