C16H21NO2 — CID 638514
(10bS)-10b-ethenyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline (PubChem CID 638514) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (10bS)-10b-ethenyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline.
| Compound Name | (10bS)-10b-ethenyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 638514 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (10bS)-10b-ethenyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline |
| SMILES | C=C[C@]12CCCN1CCc1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C16H21NO2/c1-4-16-7-5-8-17(16)9-6-12-10-14(18-2)15(19-3)11-13(12)16/h4,10-11H,1,5-9H2,2-3H3/t16-/m1/s1 |
| InChIKey | WOUPYSOCLWOQBG-MRXNPFEDSA-N |
| XLogP | 2.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|