C29H30O6 — CID 11605307
4,5,13,14,19,20-hexamethoxyhexacyclo[7.7.7.01,9.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaene (PubChem CID 11605307) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is 4,5,13,14,19,20-hexamethoxyhexacyclo[7.7.7.01,9.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaene.
| Compound Name | 4,5,13,14,19,20-hexamethoxyhexacyclo[7.7.7.01,9.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaene |
|---|---|
| PubChem CID | 11605307 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4,5,13,14,19,20-hexamethoxyhexacyclo[7.7.7.01,9.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaene |
| SMILES | COc1cc2c(cc1OC)C13c4cc(OC)c(OC)cc4CC1(C2)Cc1cc(OC)c(OC)cc13 |
| InChI | InChI=1S/C29H30O6/c1-30-22-7-16-13-28-14-17-8-23(31-2)26(34-5)11-20(17)29(28,19(16)10-25(22)33-4)21-12-27(35-6)24(32-3)9-18(21)15-28/h7-12H,13-15H2,1-6H3 |
| InChIKey | AMABVXWINLZXRR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |