C31H48O5Si — CID 155934211
[(E)-3-[(1R,2S)-5,6-dimethoxy-1-prop-2-ynyl-2-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-yl]prop-2-enyl] 2,2-dimethylpropanoate (PubChem CID 155934211) has the molecular formula C31H48O5Si and a molecular weight of 528.81 g/mol. Its IUPAC name is [(E)-3-[(1R,2S)-5,6-dimethoxy-1-prop-2-ynyl-2-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-yl]prop-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-3-[(1R,2S)-5,6-dimethoxy-1-prop-2-ynyl-2-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-yl]prop-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155934211 |
| Molecular Formula | C31H48O5Si |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | [(E)-3-[(1R,2S)-5,6-dimethoxy-1-prop-2-ynyl-2-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-yl]prop-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@@]1(/C=C/COC(=O)C(C)(C)C)c2cc(OC)c(OC)cc2C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H48O5Si/c1-13-15-31(16-14-17-35-29(32)30(8,9)10)25-20-27(34-12)26(33-11)18-24(25)19-28(31)36-37(21(2)3,22(4)5)23(6)7/h1,14,16,18,20-23,28H,15,17,19H2,2-12H3/b16-14+/t28-,31+/m0/s1 |
| InChIKey | ADWZCEQZTCZPCR-PLORLNNGSA-N |
| XLogP | 7.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|