C25H35NO8Si — CID 90662398
ethyl (1R,12S,13S,15R)-12-hydroxy-4,5-dimethoxy-15-[(E)-2-methoxyethenyl]-11-oxo-15-trimethylsilyloxy-10-azatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6-triene-13-carboxylate (PubChem CID 90662398) has the molecular formula C25H35NO8Si and a molecular weight of 505.64 g/mol. Its IUPAC name is ethyl (1R,12S,13S,15R)-12-hydroxy-4,5-dimethoxy-15-[(E)-2-methoxyethenyl]-11-oxo-15-trimethylsilyloxy-10-azatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6-triene-13-carboxylate.
| Compound Name | ethyl (1R,12S,13S,15R)-12-hydroxy-4,5-dimethoxy-15-[(E)-2-methoxyethenyl]-11-oxo-15-trimethylsilyloxy-10-azatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 90662398 |
| Molecular Formula | C25H35NO8Si |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | ethyl (1R,12S,13S,15R)-12-hydroxy-4,5-dimethoxy-15-[(E)-2-methoxyethenyl]-11-oxo-15-trimethylsilyloxy-10-azatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6-triene-13-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@](/C=C/OC)(O[Si](C)(C)C)[C@@]13c1cc(OC)c(OC)cc1CCN3C(=O)[C@H]2O |
| InChI | InChI=1S/C25H35NO8Si/c1-8-33-22(29)24-15-23(10-12-30-2,34-35(5,6)7)25(24)17-14-19(32-4)18(31-3)13-16(17)9-11-26(25)21(28)20(24)27/h10,12-14,20,27H,8-9,11,15H2,1-7H3/b12-10+/t20-,23+,24+,25+/m1/s1 |
| InChIKey | PHUOHFFITWDRJU-OLRAMAIXSA-N |
| XLogP | 2.36 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|