C23H27NO11S — CID 10602173
methyl (4aS,5R,9R,13bR)-9-acetyloxy-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate (PubChem CID 10602173) has the molecular formula C23H27NO11S and a molecular weight of 525.53 g/mol. Its IUPAC name is methyl (4aS,5R,9R,13bR)-9-acetyloxy-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate.
| Compound Name | methyl (4aS,5R,9R,13bR)-9-acetyloxy-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 10602173 |
| Molecular Formula | C23H27NO11S |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | methyl (4aS,5R,9R,13bR)-9-acetyloxy-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(=O)CC[C@@]13c1cc(OC)c(OC)cc1[C@@H](OC(C)=O)CN3C(=O)[C@@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C23H27NO11S/c1-12(25)34-18-11-24-20(27)19(35-36(5,29)30)22(21(28)33-4)10-13(26)6-7-23(22,24)15-9-17(32-3)16(31-2)8-14(15)18/h8-9,18-19H,6-7,10-11H2,1-5H3/t18-,19-,22-,23+/m0/s1 |
| InChIKey | PGZJDMNCIXSFTC-DHNNRRLOSA-N |
| XLogP | 0.62 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|