C21H23NO9S — CID 10624036
methyl (4aS,5R,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate (PubChem CID 10624036) has the molecular formula C21H23NO9S and a molecular weight of 465.48 g/mol. Its IUPAC name is methyl (4aS,5R,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate.
| Compound Name | methyl (4aS,5R,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 10624036 |
| Molecular Formula | C21H23NO9S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | methyl (4aS,5R,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-3,6-dioxo-1,2,4,5-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(=O)CC[C@@]13c1cc(OC)c(OC)cc1C=CN3C(=O)[C@@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C21H23NO9S/c1-28-15-9-12-6-8-22-18(24)17(31-32(4,26)27)20(19(25)30-3)11-13(23)5-7-21(20,22)14(12)10-16(15)29-2/h6,8-10,17H,5,7,11H2,1-4H3/t17-,20-,21+/m0/s1 |
| InChIKey | ZAZQYRRNJKZATF-DZFGPLHGSA-N |
| XLogP | 0.98 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|