C25H26N2O6 — CID 102208533
(12S)-1-(1,3-benzodioxol-5-ylmethyl)-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione (PubChem CID 102208533) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is (12S)-1-(1,3-benzodioxol-5-ylmethyl)-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione.
| Compound Name | (12S)-1-(1,3-benzodioxol-5-ylmethyl)-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione |
|---|---|
| PubChem CID | 102208533 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (12S)-1-(1,3-benzodioxol-5-ylmethyl)-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione |
| SMILES | COc1cc2c(cc1OC)C1(Cc3ccc4c(c3)OCO4)C(=O)N3CCC[C@H]3C(=O)N1CC2 |
| InChI | InChI=1S/C25H26N2O6/c1-30-20-11-16-7-9-27-23(28)18-4-3-8-26(18)24(29)25(27,17(16)12-21(20)31-2)13-15-5-6-19-22(10-15)33-14-32-19/h5-6,10-12,18H,3-4,7-9,13-14H2,1-2H3/t18-,25?/m0/s1 |
| InChIKey | HGZFRCITAYDPAO-CPFIQGLUSA-N |
| XLogP | 2.26 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |