C22H22N2O6 — CID 98299744
(3R)-1-(1,3-benzodioxol-5-yl)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione (PubChem CID 98299744) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (3R)-1-(1,3-benzodioxol-5-yl)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(1,3-benzodioxol-5-yl)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98299744 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (3R)-1-(1,3-benzodioxol-5-yl)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione |
| SMILES | COc1cc2c(cc1OC)CN([C@@H]1CC(=O)N(c3ccc4c(c3)OCO4)C1=O)CC2 |
| InChI | InChI=1S/C22H22N2O6/c1-27-18-7-13-5-6-23(11-14(13)8-19(18)28-2)16-10-21(25)24(22(16)26)15-3-4-17-20(9-15)30-12-29-17/h3-4,7-9,16H,5-6,10-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | CRBGNKHOCCAQKF-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|