C21H21N3O6 — CID 30468032
(3S)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 30468032) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is (3S)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 30468032 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (3S)-3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc2c(cc1OC)CN([C@H]1CC(=O)N(c3ccccc3[N+](=O)[O-])C1=O)CC2 |
| InChI | InChI=1S/C21H21N3O6/c1-29-18-9-13-7-8-22(12-14(13)10-19(18)30-2)17-11-20(25)23(21(17)26)15-5-3-4-6-16(15)24(27)28/h3-6,9-10,17H,7-8,11-12H2,1-2H3/t17-/m0/s1 |
| InChIKey | MNFNWCIHCYLDKF-KRWDZBQOSA-N |
| XLogP | 2.30 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|