C24H25ClN2O4 — CID 10961182
(1R,12S)-1-[(3-chlorophenyl)methyl]-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione (PubChem CID 10961182) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is (1R,12S)-1-[(3-chlorophenyl)methyl]-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione.
| Compound Name | (1R,12S)-1-[(3-chlorophenyl)methyl]-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione |
|---|---|
| PubChem CID | 10961182 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (1R,12S)-1-[(3-chlorophenyl)methyl]-4,5-dimethoxy-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione |
| SMILES | COc1cc2c(cc1OC)[C@]1(Cc3cccc(Cl)c3)C(=O)N3CCC[C@H]3C(=O)N1CC2 |
| InChI | InChI=1S/C24H25ClN2O4/c1-30-20-12-16-8-10-27-22(28)19-7-4-9-26(19)23(29)24(27,18(16)13-21(20)31-2)14-15-5-3-6-17(25)11-15/h3,5-6,11-13,19H,4,7-10,14H2,1-2H3/t19-,24+/m0/s1 |
| InChIKey | OLIOLAHAKKGPRQ-YADARESESA-N |
| XLogP | 3.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |