C25H28N2O5 — CID 102208528
(12S)-4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione (PubChem CID 102208528) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is (12S)-4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione.
| Compound Name | (12S)-4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione |
|---|---|
| PubChem CID | 102208528 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (12S)-4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6-triene-11,17-dione |
| SMILES | COc1ccc(CC23C(=O)N4CCC[C@H]4C(=O)N2CCc2cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-30-18-8-6-16(7-9-18)15-25-19-14-22(32-3)21(31-2)13-17(19)10-12-27(25)23(28)20-5-4-11-26(20)24(25)29/h6-9,13-14,20H,4-5,10-12,15H2,1-3H3/t20-,25?/m0/s1 |
| InChIKey | BTRHWRSDUIIRDF-JINQPTGOSA-N |
| XLogP | 2.54 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |