C20H28N2O3 — CID 71730310
(1R,14S,15R,16S)-15-(aminomethyl)-4,5-dimethoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2,4,6-trien-12-one (PubChem CID 71730310) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (1R,14S,15R,16S)-15-(aminomethyl)-4,5-dimethoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2,4,6-trien-12-one.
| Compound Name | (1R,14S,15R,16S)-15-(aminomethyl)-4,5-dimethoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2,4,6-trien-12-one |
|---|---|
| PubChem CID | 71730310 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (1R,14S,15R,16S)-15-(aminomethyl)-4,5-dimethoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2,4,6-trien-12-one |
| SMILES | COc1cc2c(cc1OC)[C@@]13C[C@H](C)[C@@H](CN)[C@@H]1CC(=O)N3CCC2 |
| InChI | InChI=1S/C20H28N2O3/c1-12-10-20-15-8-18(25-3)17(24-2)7-13(15)5-4-6-22(20)19(23)9-16(20)14(12)11-21/h7-8,12,14,16H,4-6,9-11,21H2,1-3H3/t12-,14+,16-,20-/m0/s1 |
| InChIKey | YZKMUTSFROLUGV-OZONBXFNSA-N |
| XLogP | 2.31 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |