C19H26N2O2 — CID 71730306
(1R,14S,15R,16S)-15-(aminomethyl)-5-methoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one (PubChem CID 71730306) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1R,14S,15R,16S)-15-(aminomethyl)-5-methoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one.
| Compound Name | (1R,14S,15R,16S)-15-(aminomethyl)-5-methoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one |
|---|---|
| PubChem CID | 71730306 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (1R,14S,15R,16S)-15-(aminomethyl)-5-methoxy-16-methyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one |
| SMILES | COc1ccc2c(c1)CCCN1C(=O)C[C@H]3[C@H](CN)[C@@H](C)C[C@]231 |
| InChI | InChI=1S/C19H26N2O2/c1-12-10-19-16-6-5-14(23-2)8-13(16)4-3-7-21(19)18(22)9-17(19)15(12)11-20/h5-6,8,12,15,17H,3-4,7,9-11,20H2,1-2H3/t12-,15+,17-,19-/m0/s1 |
| InChIKey | MCCYPGNOGAXHKD-UBTURXDTSA-N |
| XLogP | 2.30 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |