C13H19NO2 — CID 83910574
1-(2-aminoethyl)-5-methoxy-2-methyl-2,3-dihydroinden-1-ol (PubChem CID 83910574) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(2-aminoethyl)-5-methoxy-2-methyl-2,3-dihydroinden-1-ol.
| Compound Name | 1-(2-aminoethyl)-5-methoxy-2-methyl-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 83910574 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(2-aminoethyl)-5-methoxy-2-methyl-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc2c(c1)CC(C)C2(O)CCN |
| InChI | InChI=1S/C13H19NO2/c1-9-7-10-8-11(16-2)3-4-12(10)13(9,15)5-6-14/h3-4,8-9,15H,5-7,14H2,1-2H3 |
| InChIKey | KLUXGMZTZMWJKA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |