C21H26N2O7 — CID 71730571
methyl (1R,9S,13S,14R,15S)-4,5-dimethoxy-15-methyl-14-(nitromethyl)-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-9-carboxylate (PubChem CID 71730571) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl (1R,9S,13S,14R,15S)-4,5-dimethoxy-15-methyl-14-(nitromethyl)-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-9-carboxylate.
| Compound Name | methyl (1R,9S,13S,14R,15S)-4,5-dimethoxy-15-methyl-14-(nitromethyl)-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 71730571 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | methyl (1R,9S,13S,14R,15S)-4,5-dimethoxy-15-methyl-14-(nitromethyl)-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(OC)c(OC)cc2[C@@]23C[C@H](C)[C@@H](C[N+](=O)[O-])[C@@H]2CC(=O)N13 |
| InChI | InChI=1S/C21H26N2O7/c1-11-9-21-14-7-18(29-3)17(28-2)6-12(14)5-16(20(25)30-4)23(21)19(24)8-15(21)13(11)10-22(26)27/h6-7,11,13,15-16H,5,8-10H2,1-4H3/t11-,13+,15-,16-,21-/m0/s1 |
| InChIKey | GJGSQVMXNMUMSL-IIXIMBLJSA-N |
| XLogP | 1.78 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|