C18H21ClN2O7 — CID 11915472
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11915472) has the molecular formula C18H21ClN2O7 and a molecular weight of 412.83 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11915472 |
| Molecular Formula | C18H21ClN2O7 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)C[C@H]2C(=O)C[C@H](C)[C@H]2C[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H21ClN2O7/c1-10-5-15(22)12(13(10)8-21(25)26)7-18(24)28-9-17(23)20-11-3-4-16(27-2)14(19)6-11/h3-4,6,10,12-13H,5,7-9H2,1-2H3,(H,20,23)/t10-,12+,13+/m0/s1 |
| InChIKey | DFWVYYGSNCLADK-CYZMBNFOSA-N |
| XLogP | 2.34 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|