C18H21ClN2O6 — CID 7773965
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 7773965) has the molecular formula C18H21ClN2O6 and a molecular weight of 396.83 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 7773965 |
| Molecular Formula | C18H21ClN2O6 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C[C@@H]2C(=O)C[C@@H](C)[C@H]2C[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H21ClN2O6/c1-10-3-4-12(6-15(10)19)20-17(23)9-27-18(24)7-13-14(8-21(25)26)11(2)5-16(13)22/h3-4,6,11,13-14H,5,7-9H2,1-2H3,(H,20,23)/t11-,13+,14-/m1/s1 |
| InChIKey | OKEWPFQWCZVSFH-KWCYVHTRSA-N |
| XLogP | 2.64 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|