C22H32N2O6 — CID 11915293
[2-(1-adamantylmethylamino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11915293) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11915293 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@@H]1CC(=O)[C@@H](CC(=O)OCC(=O)NCC23CC4CC(CC(C4)C2)C3)[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C22H32N2O6/c1-13-2-19(25)17(18(13)10-24(28)29)6-21(27)30-11-20(26)23-12-22-7-14-3-15(8-22)5-16(4-14)9-22/h13-18H,2-12H2,1H3,(H,23,26)/t13-,14?,15?,16?,17+,18-,22?/m1/s1 |
| InChIKey | RQFAXOPUZOQHOT-DKMAEDJZSA-N |
| XLogP | 2.37 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|