C17H18F2N2O6 — CID 11915470
[2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11915470) has the molecular formula C17H18F2N2O6 and a molecular weight of 384.34 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11915470 |
| Molecular Formula | C17H18F2N2O6 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@H]1CC(=O)[C@@H](CC(=O)OCC(=O)Nc2c(F)cccc2F)[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C17H18F2N2O6/c1-9-5-14(22)10(11(9)7-21(25)26)6-16(24)27-8-15(23)20-17-12(18)3-2-4-13(17)19/h2-4,9-11H,5-8H2,1H3,(H,20,23)/t9-,10-,11+/m0/s1 |
| InChIKey | UNHLVVULJOWXJY-GARJFASQSA-N |
| XLogP | 1.95 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|