C17H25N3O7 — CID 11925715
[2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11925715) has the molecular formula C17H25N3O7 and a molecular weight of 383.40 g/mol. Its IUPAC name is [2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11925715 |
| Molecular Formula | C17H25N3O7 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-[(1R,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@H]1CC(=O)[C@H](CC(=O)OCC(=O)N(C)CC(=O)NC2CC2)[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O7/c1-10-5-14(21)12(13(10)7-20(25)26)6-17(24)27-9-16(23)19(2)8-15(22)18-11-3-4-11/h10-13H,3-9H2,1-2H3,(H,18,22)/t10-,12+,13+/m0/s1 |
| InChIKey | YZDOIOWEKCJGCF-CYZMBNFOSA-N |
| XLogP | -0.23 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|