C21H24N2O7 — CID 11923774
[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11923774) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11923774 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@H](NC(=O)COC(=O)C[C@@H]1C(=O)C[C@@H](C)[C@H]1C[N+](=O)[O-])c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H24N2O7/c1-12-7-17(24)15(16(12)10-23(27)28)9-21(26)29-11-20(25)22-13(2)19-8-14-5-3-4-6-18(14)30-19/h3-6,8,12-13,15-16H,7,9-11H2,1-2H3,(H,22,25)/t12-,13+,15+,16-/m1/s1 |
| InChIKey | BQTWRSMMILBCQV-BFJAYTPKSA-N |
| XLogP | 2.66 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|