C18H21NO4 — CID 9202178
[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] cyclopentanecarboxylate (PubChem CID 9202178) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] cyclopentanecarboxylate.
| Compound Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 9202178 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] cyclopentanecarboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)C1CCCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H21NO4/c1-12(16-10-14-8-4-5-9-15(14)23-16)19-17(20)11-22-18(21)13-6-2-3-7-13/h4-5,8-10,12-13H,2-3,6-7,11H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | OZGNCCIUMFBNPD-LBPRGKRZSA-N |
| XLogP | 3.34 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |