C20H18BrNO4 — CID 9342634
[2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 9342634) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 9342634 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | [2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)Cc1ccc(Br)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H18BrNO4/c1-13(18-11-15-4-2-3-5-17(15)26-18)22-19(23)12-25-20(24)10-14-6-8-16(21)9-7-14/h2-9,11,13H,10,12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | WHPJQSSGDXGCTH-CYBMUJFWSA-N |
| XLogP | 4.16 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |