About [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate
[2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 4239088) has the molecular formula C18H13BrO4
and a molecular weight of 373.20 g/mol. Its IUPAC name is [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate.
Molecular Properties
| Compound Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate |
| PubChem CID | 4239088 |
| Molecular Formula | C18H13BrO4 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | O=C(Cc1ccc(Br)cc1)OCC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H13BrO4/c19-14-7-5-12(6-8-14)9-18(21)22-11-15(20)17-10-13-3-1-2-4-16(13)23-17/h1-8,10H,9,11H2 |
| InChIKey | FMSLUTNGEYWNLW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate?
The IUPAC name of [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate (CID 4239088) is [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate.
What is the SMILES notation for [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate?
The canonical SMILES for [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate is O=C(Cc1ccc(Br)cc1)OCC(=O)c1cc2ccccc2o1.
What is the InChIKey of [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate?
The InChIKey is FMSLUTNGEYWNLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO4/c19-14-7-5-12(6-8-14)9-18(21)22-11-15(20)17-10-13-3-1-2-4-16(13)23-17/h1-8,10H,9,11H2.
What are the key properties of [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate?
[2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate has a molecular weight of 373.20 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(4-bromophenyl)acetate is sourced from PubChem (CID 4239088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).