C17H12O7 — CID 23965063
[2-(1-benzofuran-2-yl)-2-oxoethyl] 3,4,5-trihydroxybenzoate (PubChem CID 23965063) has the molecular formula C17H12O7 and a molecular weight of 328.28 g/mol. Its IUPAC name is [2-(1-benzofuran-2-yl)-2-oxoethyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 23965063 |
| Molecular Formula | C17H12O7 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OCC(=O)c1cc2ccccc2o1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C17H12O7/c18-11-5-10(6-12(19)16(11)21)17(22)23-8-13(20)15-7-9-3-1-2-4-14(9)24-15/h1-7,18-19,21H,8H2 |
| InChIKey | HULGEDBOELPFCF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|