C20H18O4 — CID 7210520
[2-oxo-2-(4-propylphenyl)ethyl] 1-benzofuran-2-carboxylate (PubChem CID 7210520) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-oxo-2-(4-propylphenyl)ethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(4-propylphenyl)ethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7210520 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [2-oxo-2-(4-propylphenyl)ethyl] 1-benzofuran-2-carboxylate |
| SMILES | CCCc1ccc(C(=O)COC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H18O4/c1-2-5-14-8-10-15(11-9-14)17(21)13-23-20(22)19-12-16-6-3-4-7-18(16)24-19/h3-4,6-12H,2,5,13H2,1H3 |
| InChIKey | IVEKGTJPIGIPKK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |