C20H13NO6 — CID 8891276
[2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 8891276) has the molecular formula C20H13NO6 and a molecular weight of 363.33 g/mol. Its IUPAC name is [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 8891276 |
| Molecular Formula | C20H13NO6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H13NO6/c22-15(17-9-12-5-1-4-8-16(12)27-17)11-26-18(23)10-21-19(24)13-6-2-3-7-14(13)20(21)25/h1-9H,10-11H2 |
| InChIKey | IMKFMAZUNMAWGH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|