C15H23N3O7 — CID 11923750
[2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11923750) has the molecular formula C15H23N3O7 and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11923750 |
| Molecular Formula | C15H23N3O7 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | CNC(=O)CN(C)C(=O)COC(=O)C[C@@H]1C(=O)C[C@H](C)[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O7/c1-9-4-12(19)10(11(9)6-18(23)24)5-15(22)25-8-14(21)17(3)7-13(20)16-2/h9-11H,4-8H2,1-3H3,(H,16,20)/t9-,10-,11+/m0/s1 |
| InChIKey | BLODGMULBVKQEL-GARJFASQSA-N |
| XLogP | -0.76 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|