C14H17N3O6S — CID 8578797
[2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 8578797) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
| Compound Name | [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8578797 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | CNC(=O)CN(C)C(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O6S/c1-15-12(18)7-16(2)13(19)8-23-14(20)9-24-11-5-3-10(4-6-11)17(21)22/h3-6H,7-9H2,1-2H3,(H,15,18) |
| InChIKey | PZBQPKYMZCWHOU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|