C17H22N2O7S — CID 8578808
methyl (2R)-4-methyl-2-[[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]amino]pentanoate (PubChem CID 8578808) has the molecular formula C17H22N2O7S and a molecular weight of 398.44 g/mol. Its IUPAC name is methyl (2R)-4-methyl-2-[[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]amino]pentanoate.
| Compound Name | methyl (2R)-4-methyl-2-[[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]amino]pentanoate |
|---|---|
| PubChem CID | 8578808 |
| Molecular Formula | C17H22N2O7S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | methyl (2R)-4-methyl-2-[[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]amino]pentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O7S/c1-11(2)8-14(17(22)25-3)18-15(20)9-26-16(21)10-27-13-6-4-12(5-7-13)19(23)24/h4-7,11,14H,8-10H2,1-3H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | WHWPZOOOKFQINT-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|