C12H19NO — CID 85106790
1,2,3,4,7,7a,8,9,10,11-decahydropyrido[2,1-i]indol-6-one (PubChem CID 85106790) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1,2,3,4,7,7a,8,9,10,11-decahydropyrido[2,1-i]indol-6-one.
| Compound Name | 1,2,3,4,7,7a,8,9,10,11-decahydropyrido[2,1-i]indol-6-one |
|---|---|
| PubChem CID | 85106790 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1,2,3,4,7,7a,8,9,10,11-decahydropyrido[2,1-i]indol-6-one |
| SMILES | O=C1CC2CCCCC23CCCCN13 |
| InChI | InChI=1S/C12H19NO/c14-11-9-10-5-1-2-6-12(10)7-3-4-8-13(11)12/h10H,1-9H2 |
| InChIKey | XEWAGBQWGMBTIG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |