C21H19NO4 — CID 87387292
(10Z)-spiro[1-azatricyclo[6.5.1.04,14]tetradeca-3,8(14),10-triene-13,7'-6H-furo[2,3-f][1,3]benzodioxole]-12-one (PubChem CID 87387292) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (10Z)-spiro[1-azatricyclo[6.5.1.04,14]tetradeca-3,8(14),10-triene-13,7'-6H-furo[2,3-f][1,3]benzodioxole]-12-one.
| Compound Name | (10Z)-spiro[1-azatricyclo[6.5.1.04,14]tetradeca-3,8(14),10-triene-13,7'-6H-furo[2,3-f][1,3]benzodioxole]-12-one |
|---|---|
| PubChem CID | 87387292 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (10Z)-spiro[1-azatricyclo[6.5.1.04,14]tetradeca-3,8(14),10-triene-13,7'-6H-furo[2,3-f][1,3]benzodioxole]-12-one |
| SMILES | O=C1/C=C\CC2=C3C(=CCN3C13COc1cc4c(cc13)OCO4)CCC2 |
| InChI | InChI=1S/C21H19NO4/c23-19-6-2-5-13-3-1-4-14-7-8-22(20(13)14)21(19)11-24-16-10-18-17(9-15(16)21)25-12-26-18/h2,6-7,9-10H,1,3-5,8,11-12H2/b6-2- |
| InChIKey | CDDQFBQKGRKJRE-KXFIGUGUSA-N |
| XLogP | 3.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |