C11H11NO2 — CID 152590822
5-methyl-6H-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 152590822) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 5-methyl-6H-[1,3]dioxolo[4,5-g]quinoline.
| Compound Name | 5-methyl-6H-[1,3]dioxolo[4,5-g]quinoline |
|---|---|
| PubChem CID | 152590822 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 5-methyl-6H-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | CN1CC=Cc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C11H11NO2/c1-12-4-2-3-8-5-10-11(6-9(8)12)14-7-13-10/h2-3,5-6H,4,7H2,1H3 |
| InChIKey | YVLIFTJAUPJRKP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|