C17H17NO6 — CID 175665041
(2S,4R,5R,7S,13R)-5,13-dihydroxy-3,17,19-trioxa-11-azahexacyclo[12.7.0.02,4.02,7.07,11.016,20]henicosa-1(21),14,16(20)-trien-10-one (PubChem CID 175665041) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is (2S,4R,5R,7S,13R)-5,13-dihydroxy-3,17,19-trioxa-11-azahexacyclo[12.7.0.02,4.02,7.07,11.016,20]henicosa-1(21),14,16(20)-trien-10-one.
| Compound Name | (2S,4R,5R,7S,13R)-5,13-dihydroxy-3,17,19-trioxa-11-azahexacyclo[12.7.0.02,4.02,7.07,11.016,20]henicosa-1(21),14,16(20)-trien-10-one |
|---|---|
| PubChem CID | 175665041 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2S,4R,5R,7S,13R)-5,13-dihydroxy-3,17,19-trioxa-11-azahexacyclo[12.7.0.02,4.02,7.07,11.016,20]henicosa-1(21),14,16(20)-trien-10-one |
| SMILES | O=C1CC[C@]23C[C@@H](O)[C@H]4O[C@]42c2cc4c(cc2[C@@H](O)CN13)OCO4 |
| InChI | InChI=1S/C17H17NO6/c19-10-5-16-2-1-14(21)18(16)6-11(20)8-3-12-13(23-7-22-12)4-9(8)17(16)15(10)24-17/h3-4,10-11,15,19-20H,1-2,5-7H2/t10-,11+,15-,16+,17-/m1/s1 |
| InChIKey | NMPYTZHCHOUHGJ-XNMUYTFRSA-N |
| XLogP | 0.18 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|