C18H19NO5 — CID 163090146
(6S,12R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,4,13,15(19)-pentaene-3,12-diol (PubChem CID 163090146) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is (6S,12R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,4,13,15(19)-pentaene-3,12-diol.
| Compound Name | (6S,12R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,4,13,15(19)-pentaene-3,12-diol |
|---|---|
| PubChem CID | 163090146 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (6S,12R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,4,13,15(19)-pentaene-3,12-diol |
| SMILES | COC1=C[C@]23CCCN2C[C@H](O)c2cc4c(cc2C3=C1O)OCO4 |
| InChI | InChI=1S/C18H19NO5/c1-22-15-7-18-3-2-4-19(18)8-12(20)10-5-13-14(24-9-23-13)6-11(10)16(18)17(15)21/h5-7,12,20-21H,2-4,8-9H2,1H3/t12-,18-/m0/s1 |
| InChIKey | PRTXFEFIDMUDQQ-SGTLLEGYSA-N |
| XLogP | 2.11 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |